C20H26O5Si2 — CID 19914120
4-(4-carboxy-3-trimethylsilylphenoxy)-2-trimethylsilylbenzoic acid (PubChem CID 19914120) has the molecular formula C20H26O5Si2 and a molecular weight of 402.60 g/mol. Its IUPAC name is 4-(4-carboxy-3-trimethylsilylphenoxy)-2-trimethylsilylbenzoic acid.
| Compound Name | 4-(4-carboxy-3-trimethylsilylphenoxy)-2-trimethylsilylbenzoic acid |
|---|---|
| PubChem CID | 19914120 |
| Molecular Formula | C20H26O5Si2 |
| Molecular Weight | 402.60 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 4-(4-carboxy-3-trimethylsilylphenoxy)-2-trimethylsilylbenzoic acid |
| SMILES | C[Si](C)(C)c1cc(Oc2ccc(C(=O)O)c([Si](C)(C)C)c2)ccc1C(=O)O |
| InChI | InChI=1S/C20H26O5Si2/c1-26(2,3)17-11-13(7-9-15(17)19(21)22)25-14-8-10-16(20(23)24)18(12-14)27(4,5)6/h7-12H,1-6H3,(H,21,22)(H,23,24) |
| InChIKey | XLYZWNVGTPCNIJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.60 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|