C38H32O13 — CID 150625871
4-[4-[3-[4-(3,4-dicarboxyphenoxy)phenyl]-2,11-dioxo-oxacycloundec-3-yl]phenoxy]phthalic acid (PubChem CID 150625871) has the molecular formula C38H32O13 and a molecular weight of 696.66 g/mol. Its IUPAC name is 4-[4-[3-[4-(3,4-dicarboxyphenoxy)phenyl]-2,11-dioxo-oxacycloundec-3-yl]phenoxy]phthalic acid.
| Compound Name | 4-[4-[3-[4-(3,4-dicarboxyphenoxy)phenyl]-2,11-dioxo-oxacycloundec-3-yl]phenoxy]phthalic acid |
|---|---|
| PubChem CID | 150625871 |
| Molecular Formula | C38H32O13 |
| Molecular Weight | 696.66 g/mol |
| Exact Mass | 696.18 |
| IUPAC Name | 4-[4-[3-[4-(3,4-dicarboxyphenoxy)phenyl]-2,11-dioxo-oxacycloundec-3-yl]phenoxy]phthalic acid |
| SMILES | O=C1CCCCCCCC(c2ccc(Oc3ccc(C(=O)O)c(C(=O)O)c3)cc2)(c2ccc(Oc3ccc(C(=O)O)c(C(=O)O)c3)cc2)C(=O)O1 |
| InChI | InChI=1S/C38H32O13/c39-32-6-4-2-1-3-5-19-38(37(48)51-32,22-7-11-24(12-8-22)49-26-15-17-28(33(40)41)30(20-26)35(44)45)23-9-13-25(14-10-23)50-27-16-18-29(34(42)43)31(21-27)36(46)47/h7-18,20-21H,1-6,19H2,(H,40,41)(H,42,43)(H,44,45)(H,46,47) |
| InChIKey | IWWHYIJEGGHTHG-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 211.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.66 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|