C25H16F6O10 — CID 89052914
4-[1-(3,4-dicarboxyphenoxy)-6-(1,2,2,3,3,3-hexafluoropropyl)cyclohexa-2,4-dien-1-yl]oxyphthalic acid (PubChem CID 89052914) has the molecular formula C25H16F6O10 and a molecular weight of 590.38 g/mol. Its IUPAC name is 4-[1-(3,4-dicarboxyphenoxy)-6-(1,2,2,3,3,3-hexafluoropropyl)cyclohexa-2,4-dien-1-yl]oxyphthalic acid.
| Compound Name | 4-[1-(3,4-dicarboxyphenoxy)-6-(1,2,2,3,3,3-hexafluoropropyl)cyclohexa-2,4-dien-1-yl]oxyphthalic acid |
|---|---|
| PubChem CID | 89052914 |
| Molecular Formula | C25H16F6O10 |
| Molecular Weight | 590.38 g/mol |
| Exact Mass | 590.06 |
| IUPAC Name | 4-[1-(3,4-dicarboxyphenoxy)-6-(1,2,2,3,3,3-hexafluoropropyl)cyclohexa-2,4-dien-1-yl]oxyphthalic acid |
| SMILES | O=C(O)c1ccc(OC2(Oc3ccc(C(=O)O)c(C(=O)O)c3)C=CC=CC2C(F)C(F)(F)C(F)(F)F)cc1C(=O)O |
| InChI | InChI=1S/C25H16F6O10/c26-18(24(27,28)25(29,30)31)17-3-1-2-8-23(17,40-11-4-6-13(19(32)33)15(9-11)21(36)37)41-12-5-7-14(20(34)35)16(10-12)22(38)39/h1-10,17-18H,(H,32,33)(H,34,35)(H,36,37)(H,38,39) |
| InChIKey | WOKGVMUHOUJPSC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.38 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|