C11H6F6O4 — CID 23501976
4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phthalic acid (PubChem CID 23501976) has the molecular formula C11H6F6O4 and a molecular weight of 316.15 g/mol. Its IUPAC name is 4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phthalic acid.
| Compound Name | 4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phthalic acid |
|---|---|
| PubChem CID | 23501976 |
| Molecular Formula | C11H6F6O4 |
| Molecular Weight | 316.15 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phthalic acid |
| SMILES | O=C(O)c1ccc(C(F)(C(F)F)C(F)(F)F)cc1C(=O)O |
| InChI | InChI=1S/C11H6F6O4/c12-9(13)10(14,11(15,16)17)4-1-2-5(7(18)19)6(3-4)8(20)21/h1-3,9H,(H,18,19)(H,20,21) |
| InChIKey | KGQGFYHSZPZMEQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.15 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |