4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phthalic acid

C11H6F6O4 — CID 23501976

IUPAC4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phthalic acid
SMILESO=C(O)c1ccc(C(F)(C(F)F)C(F)(F)F)cc1C(=O)O
InChIInChI=1S/C11H6F6O4/c12-9(13)10(14,11(15,16)17)4-1-2-5(7(18)19)6(3-4)8(20)21/h1-3,9H,(H,18,19)(H,20,21)
InChIKeyKGQGFYHSZPZMEQ-UHFFFAOYSA-N
MW316.15 g/mol
LogP3.08
Rot. Bonds4

About 4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phthalic acid

4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phthalic acid (PubChem CID 23501976) has the molecular formula C11H6F6O4 and a molecular weight of 316.15 g/mol. Its IUPAC name is 4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phthalic acid.

Molecular Properties

Compound Name4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phthalic acid
PubChem CID23501976
Molecular FormulaC11H6F6O4
Molecular Weight316.15 g/mol
Exact Mass316.02
IUPAC Name4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phthalic acid
SMILESO=C(O)c1ccc(C(F)(C(F)F)C(F)(F)F)cc1C(=O)O
InChIInChI=1S/C11H6F6O4/c12-9(13)10(14,11(15,16)17)4-1-2-5(7(18)19)6(3-4)8(20)21/h1-3,9H,(H,18,19)(H,20,21)
InChIKeyKGQGFYHSZPZMEQ-UHFFFAOYSA-N
XLogP3.08
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500316.15
LogP ≤ 53.08
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phthalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phthalic acid?
The IUPAC name of 4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phthalic acid (CID 23501976) is 4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phthalic acid.
What is the SMILES notation for 4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phthalic acid?
The canonical SMILES for 4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phthalic acid is O=C(O)c1ccc(C(F)(C(F)F)C(F)(F)F)cc1C(=O)O.
What is the InChIKey of 4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phthalic acid?
The InChIKey is KGQGFYHSZPZMEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6F6O4/c12-9(13)10(14,11(15,16)17)4-1-2-5(7(18)19)6(3-4)8(20)21/h1-3,9H,(H,18,19)(H,20,21).
What are the key properties of 4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phthalic acid?
4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phthalic acid has a molecular weight of 316.15 g/mol, XLogP of 3.08, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phthalic acid is sourced from PubChem (CID 23501976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).