C18H10F4O8 — CID 118000585
4-[2-(3,4-dicarboxyphenyl)-1,1,2,2-tetrafluoroethyl]phthalic acid (PubChem CID 118000585) has the molecular formula C18H10F4O8 and a molecular weight of 430.26 g/mol. Its IUPAC name is 4-[2-(3,4-dicarboxyphenyl)-1,1,2,2-tetrafluoroethyl]phthalic acid.
| Compound Name | 4-[2-(3,4-dicarboxyphenyl)-1,1,2,2-tetrafluoroethyl]phthalic acid |
|---|---|
| PubChem CID | 118000585 |
| Molecular Formula | C18H10F4O8 |
| Molecular Weight | 430.26 g/mol |
| Exact Mass | 430.03 |
| IUPAC Name | 4-[2-(3,4-dicarboxyphenyl)-1,1,2,2-tetrafluoroethyl]phthalic acid |
| SMILES | O=C(O)c1ccc(C(F)(F)C(F)(F)c2ccc(C(=O)O)c(C(=O)O)c2)cc1C(=O)O |
| InChI | InChI=1S/C18H10F4O8/c19-17(20,7-1-3-9(13(23)24)11(5-7)15(27)28)18(21,22)8-2-4-10(14(25)26)12(6-8)16(29)30/h1-6H,(H,23,24)(H,25,26)(H,27,28)(H,29,30) |
| InChIKey | MIBVLZCMEJIFDL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.26 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|