C19H8F12O4 — CID 22908511
4-[2-[4-carboxy-3-(trifluoromethyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(trifluoromethyl)benzoic acid (PubChem CID 22908511) has the molecular formula C19H8F12O4 and a molecular weight of 528.25 g/mol. Its IUPAC name is 4-[2-[4-carboxy-3-(trifluoromethyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(trifluoromethyl)benzoic acid.
| Compound Name | 4-[2-[4-carboxy-3-(trifluoromethyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 22908511 |
| Molecular Formula | C19H8F12O4 |
| Molecular Weight | 528.25 g/mol |
| Exact Mass | 528.02 |
| IUPAC Name | 4-[2-[4-carboxy-3-(trifluoromethyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1ccc(C(c2ccc(C(=O)O)c(C(F)(F)F)c2)(C(F)(F)F)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C19H8F12O4/c20-16(21,22)11-5-7(1-3-9(11)13(32)33)15(18(26,27)28,19(29,30)31)8-2-4-10(14(34)35)12(6-8)17(23,24)25/h1-6H,(H,32,33)(H,34,35) |
| InChIKey | DJJQOLCXUZEUCQ-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.25 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |