C25H14F6O8 — CID 141070674
4-[1-(3,4-dicarboxyphenyl)-2,2,2-trifluoro-1-[4-(trifluoromethyl)phenyl]ethyl]phthalic acid (PubChem CID 141070674) has the molecular formula C25H14F6O8 and a molecular weight of 556.37 g/mol. Its IUPAC name is 4-[1-(3,4-dicarboxyphenyl)-2,2,2-trifluoro-1-[4-(trifluoromethyl)phenyl]ethyl]phthalic acid.
| Compound Name | 4-[1-(3,4-dicarboxyphenyl)-2,2,2-trifluoro-1-[4-(trifluoromethyl)phenyl]ethyl]phthalic acid |
|---|---|
| PubChem CID | 141070674 |
| Molecular Formula | C25H14F6O8 |
| Molecular Weight | 556.37 g/mol |
| Exact Mass | 556.06 |
| IUPAC Name | 4-[1-(3,4-dicarboxyphenyl)-2,2,2-trifluoro-1-[4-(trifluoromethyl)phenyl]ethyl]phthalic acid |
| SMILES | O=C(O)c1ccc(C(c2ccc(C(F)(F)F)cc2)(c2ccc(C(=O)O)c(C(=O)O)c2)C(F)(F)F)cc1C(=O)O |
| InChI | InChI=1S/C25H14F6O8/c26-24(27,28)12-3-1-11(2-4-12)23(25(29,30)31,13-5-7-15(19(32)33)17(9-13)21(36)37)14-6-8-16(20(34)35)18(10-14)22(38)39/h1-10H,(H,32,33)(H,34,35)(H,36,37)(H,38,39) |
| InChIKey | CMIPTAQSQJGMMJ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.37 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|