C17H14F3NO2 — CID 163536086
2-(methylideneamino)-4-[2-[4-(trifluoromethyl)phenyl]ethyl]benzoic acid (PubChem CID 163536086) has the molecular formula C17H14F3NO2 and a molecular weight of 321.30 g/mol. Its IUPAC name is 2-(methylideneamino)-4-[2-[4-(trifluoromethyl)phenyl]ethyl]benzoic acid.
| Compound Name | 2-(methylideneamino)-4-[2-[4-(trifluoromethyl)phenyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 163536086 |
| Molecular Formula | C17H14F3NO2 |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 2-(methylideneamino)-4-[2-[4-(trifluoromethyl)phenyl]ethyl]benzoic acid |
| SMILES | C=Nc1cc(CCc2ccc(C(F)(F)F)cc2)ccc1C(=O)O |
| InChI | InChI=1S/C17H14F3NO2/c1-21-15-10-12(6-9-14(15)16(22)23)3-2-11-4-7-13(8-5-11)17(18,19)20/h4-10H,1-3H2,(H,22,23) |
| InChIKey | DXBZDCVSRJVMTJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|