C16H11F4NO3S — CID 155187973
4-fluoro-2-[[4-(trifluoromethyl)phenyl]methylsulfanylcarbonylamino]benzoic acid (PubChem CID 155187973) has the molecular formula C16H11F4NO3S and a molecular weight of 373.33 g/mol. Its IUPAC name is 4-fluoro-2-[[4-(trifluoromethyl)phenyl]methylsulfanylcarbonylamino]benzoic acid.
| Compound Name | 4-fluoro-2-[[4-(trifluoromethyl)phenyl]methylsulfanylcarbonylamino]benzoic acid |
|---|---|
| PubChem CID | 155187973 |
| Molecular Formula | C16H11F4NO3S |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 4-fluoro-2-[[4-(trifluoromethyl)phenyl]methylsulfanylcarbonylamino]benzoic acid |
| SMILES | O=C(Nc1cc(F)ccc1C(=O)O)SCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H11F4NO3S/c17-11-5-6-12(14(22)23)13(7-11)21-15(24)25-8-9-1-3-10(4-2-9)16(18,19)20/h1-7H,8H2,(H,21,24)(H,22,23) |
| InChIKey | NQSSBCAXYJHFCI-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|