C19H13F3O8 — CID 159105724
bis(carbon dioxide);4-(1,1,1-trifluoro-2-phenylpropan-2-yl)phthalic acid (PubChem CID 159105724) has the molecular formula C19H13F3O8 and a molecular weight of 426.30 g/mol. Its IUPAC name is bis(carbon dioxide);4-(1,1,1-trifluoro-2-phenylpropan-2-yl)phthalic acid.
| Compound Name | bis(carbon dioxide);4-(1,1,1-trifluoro-2-phenylpropan-2-yl)phthalic acid |
|---|---|
| PubChem CID | 159105724 |
| Molecular Formula | C19H13F3O8 |
| Molecular Weight | 426.30 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | bis(carbon dioxide);4-(1,1,1-trifluoro-2-phenylpropan-2-yl)phthalic acid |
| SMILES | CC(c1ccccc1)(c1ccc(C(=O)O)c(C(=O)O)c1)C(F)(F)F.O=C=O.O=C=O |
| InChI | InChI=1S/C17H13F3O4.2CO2/c1-16(17(18,19)20,10-5-3-2-4-6-10)11-7-8-12(14(21)22)13(9-11)15(23)24;2*2-1-3/h2-9H,1H3,(H,21,22)(H,23,24);; |
| InChIKey | KDVYAANYUGHGJA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 142.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |