C16H8BrF7O4 — CID 157176978
5-bromo-2-fluorobenzoic acid;2-fluoro-5-(1,1,2,2,2-pentafluoroethyl)benzoic acid (PubChem CID 157176978) has the molecular formula C16H8BrF7O4 and a molecular weight of 477.13 g/mol. Its IUPAC name is 5-bromo-2-fluorobenzoic acid;2-fluoro-5-(1,1,2,2,2-pentafluoroethyl)benzoic acid.
| Compound Name | 5-bromo-2-fluorobenzoic acid;2-fluoro-5-(1,1,2,2,2-pentafluoroethyl)benzoic acid |
|---|---|
| PubChem CID | 157176978 |
| Molecular Formula | C16H8BrF7O4 |
| Molecular Weight | 477.13 g/mol |
| Exact Mass | 475.95 |
| IUPAC Name | 5-bromo-2-fluorobenzoic acid;2-fluoro-5-(1,1,2,2,2-pentafluoroethyl)benzoic acid |
| SMILES | O=C(O)c1cc(Br)ccc1F.O=C(O)c1cc(C(F)(F)C(F)(F)F)ccc1F |
| InChI | InChI=1S/C9H4F6O2.C7H4BrFO2/c10-6-2-1-4(3-5(6)7(16)17)8(11,12)9(13,14)15;8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,(H,16,17);1-3H,(H,10,11) |
| InChIKey | AOCWQEWKTZTBHF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.13 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|