C16H13Br2F2NO3 — CID 158616981
5-bromo-2-fluorobenzoic acid;5-bromo-2-fluoro-N,N-dimethylbenzamide (PubChem CID 158616981) has the molecular formula C16H13Br2F2NO3 and a molecular weight of 465.09 g/mol. Its IUPAC name is 5-bromo-2-fluorobenzoic acid;5-bromo-2-fluoro-N,N-dimethylbenzamide.
| Compound Name | 5-bromo-2-fluorobenzoic acid;5-bromo-2-fluoro-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 158616981 |
| Molecular Formula | C16H13Br2F2NO3 |
| Molecular Weight | 465.09 g/mol |
| Exact Mass | 462.92 |
| IUPAC Name | 5-bromo-2-fluorobenzoic acid;5-bromo-2-fluoro-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cc(Br)ccc1F.O=C(O)c1cc(Br)ccc1F |
| InChI | InChI=1S/C9H9BrFNO.C7H4BrFO2/c1-12(2)9(13)7-5-6(10)3-4-8(7)11;8-4-1-2-6(9)5(3-4)7(10)11/h3-5H,1-2H3;1-3H,(H,10,11) |
| InChIKey | HXMZPADBDXZSCC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.09 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |