C33H14Br4F10O10 — CID 19931489
4-[2,6-dibromo-4-[5-[3,5-dibromo-4-(3,4-dicarboxyphenoxy)phenyl]-1,1,2,2,3,3,4,4,5,5-decafluoropentyl]phenoxy]phthalic acid (PubChem CID 19931489) has the molecular formula C33H14Br4F10O10 and a molecular weight of 1080.06 g/mol. Its IUPAC name is 4-[2,6-dibromo-4-[5-[3,5-dibromo-4-(3,4-dicarboxyphenoxy)phenyl]-1,1,2,2,3,3,4,4,5,5-decafluoropentyl]phenoxy]phthalic acid.
| Compound Name | 4-[2,6-dibromo-4-[5-[3,5-dibromo-4-(3,4-dicarboxyphenoxy)phenyl]-1,1,2,2,3,3,4,4,5,5-decafluoropentyl]phenoxy]phthalic acid |
|---|---|
| PubChem CID | 19931489 |
| Molecular Formula | C33H14Br4F10O10 |
| Molecular Weight | 1080.06 g/mol |
| Exact Mass | 1075.72 |
| IUPAC Name | 4-[2,6-dibromo-4-[5-[3,5-dibromo-4-(3,4-dicarboxyphenoxy)phenyl]-1,1,2,2,3,3,4,4,5,5-decafluoropentyl]phenoxy]phthalic acid |
| SMILES | O=C(O)c1ccc(Oc2c(Br)cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)c3cc(Br)c(Oc4ccc(C(=O)O)c(C(=O)O)c4)c(Br)c3)cc2Br)cc1C(=O)O |
| InChI | InChI=1S/C33H14Br4F10O10/c34-19-5-11(6-20(35)23(19)56-13-1-3-15(25(48)49)17(9-13)27(52)53)29(38,39)31(42,43)33(46,47)32(44,45)30(40,41)12-7-21(36)24(22(37)8-12)57-14-2-4-16(26(50)51)18(10-14)28(54)55/h1-10H,(H,48,49)(H,50,51)(H,52,53)(H,54,55) |
| InChIKey | VURAAWHQQHBMIZ-UHFFFAOYSA-N |
| XLogP | 11.90 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1080.06 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|