C29H14Br4F6O6 — CID 88641419
4-[2,6-dibromo-4-[2-[3,5-dibromo-4-(4-carboxyphenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]benzoic acid (PubChem CID 88641419) has the molecular formula C29H14Br4F6O6 and a molecular weight of 892.03 g/mol. Its IUPAC name is 4-[2,6-dibromo-4-[2-[3,5-dibromo-4-(4-carboxyphenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]benzoic acid.
| Compound Name | 4-[2,6-dibromo-4-[2-[3,5-dibromo-4-(4-carboxyphenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]benzoic acid |
|---|---|
| PubChem CID | 88641419 |
| Molecular Formula | C29H14Br4F6O6 |
| Molecular Weight | 892.03 g/mol |
| Exact Mass | 887.74 |
| IUPAC Name | 4-[2,6-dibromo-4-[2-[3,5-dibromo-4-(4-carboxyphenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(Oc2c(Br)cc(C(c3cc(Br)c(Oc4ccc(C(=O)O)cc4)c(Br)c3)(C(F)(F)F)C(F)(F)F)cc2Br)cc1 |
| InChI | InChI=1S/C29H14Br4F6O6/c30-19-9-15(10-20(31)23(19)44-17-5-1-13(2-6-17)25(40)41)27(28(34,35)36,29(37,38)39)16-11-21(32)24(22(33)12-16)45-18-7-3-14(4-8-18)26(42)43/h1-12H,(H,40,41)(H,42,43) |
| InChIKey | AZYJWYXOLXCYSY-UHFFFAOYSA-N |
| XLogP | 11.13 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 892.03 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |