C17H10F6O5 — CID 150408794
4-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]phthalic acid (PubChem CID 150408794) has the molecular formula C17H10F6O5 and a molecular weight of 408.25 g/mol. Its IUPAC name is 4-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]phthalic acid.
| Compound Name | 4-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]phthalic acid |
|---|---|
| PubChem CID | 150408794 |
| Molecular Formula | C17H10F6O5 |
| Molecular Weight | 408.25 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | 4-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phenyl]phthalic acid |
| SMILES | O=C(O)c1ccc(-c2cccc(OC(C(F)(F)F)C(F)(F)F)c2)cc1C(=O)O |
| InChI | InChI=1S/C17H10F6O5/c18-16(19,20)15(17(21,22)23)28-10-3-1-2-8(6-10)9-4-5-11(13(24)25)12(7-9)14(26)27/h1-7,15H,(H,24,25)(H,26,27) |
| InChIKey | HFIQBSPXSSOSKJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.25 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |