C25H28O2 — CID 149132545
[5-(1-adamantyl)-2-methoxyphenyl]-(4-methylphenyl)methanone (PubChem CID 149132545) has the molecular formula C25H28O2 and a molecular weight of 360.50 g/mol. Its IUPAC name is [5-(1-adamantyl)-2-methoxyphenyl]-(4-methylphenyl)methanone.
| Compound Name | [5-(1-adamantyl)-2-methoxyphenyl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 149132545 |
| Molecular Formula | C25H28O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | [5-(1-adamantyl)-2-methoxyphenyl]-(4-methylphenyl)methanone |
| SMILES | COc1ccc(C23CC4CC(CC(C4)C2)C3)cc1C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H28O2/c1-16-3-5-20(6-4-16)24(26)22-12-21(7-8-23(22)27-2)25-13-17-9-18(14-25)11-19(10-17)15-25/h3-8,12,17-19H,9-11,13-15H2,1-2H3 |
| InChIKey | RCYTWJQFBBREOC-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |