C27H30O4 — CID 67598085
3-[5-(1-adamantyl)-2-methoxyphenyl]-3-methyl-2H-1-benzofuran-5-carboxylic acid (PubChem CID 67598085) has the molecular formula C27H30O4 and a molecular weight of 418.53 g/mol. Its IUPAC name is 3-[5-(1-adamantyl)-2-methoxyphenyl]-3-methyl-2H-1-benzofuran-5-carboxylic acid.
| Compound Name | 3-[5-(1-adamantyl)-2-methoxyphenyl]-3-methyl-2H-1-benzofuran-5-carboxylic acid |
|---|---|
| PubChem CID | 67598085 |
| Molecular Formula | C27H30O4 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 3-[5-(1-adamantyl)-2-methoxyphenyl]-3-methyl-2H-1-benzofuran-5-carboxylic acid |
| SMILES | COc1ccc(C23CC4CC(CC(C4)C2)C3)cc1C1(C)COc2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C27H30O4/c1-26(15-31-24-5-3-19(25(28)29)10-21(24)26)22-11-20(4-6-23(22)30-2)27-12-16-7-17(13-27)9-18(8-16)14-27/h3-6,10-11,16-18H,7-9,12-15H2,1-2H3,(H,28,29) |
| InChIKey | XDMWCQRUFIRKSM-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |