C29H30O5 — CID 101356326
4-[4-methoxy-3-(4-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecanyl)benzoyl]oxybenzoic acid (PubChem CID 101356326) has the molecular formula C29H30O5 and a molecular weight of 458.55 g/mol. Its IUPAC name is 4-[4-methoxy-3-(4-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecanyl)benzoyl]oxybenzoic acid.
| Compound Name | 4-[4-methoxy-3-(4-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecanyl)benzoyl]oxybenzoic acid |
|---|---|
| PubChem CID | 101356326 |
| Molecular Formula | C29H30O5 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 4-[4-methoxy-3-(4-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecanyl)benzoyl]oxybenzoic acid |
| SMILES | COc1ccc(C(=O)Oc2ccc(C(=O)O)cc2)cc1C12CC3C4CC5CC3C(C1)C(C5)C4C2 |
| InChI | InChI=1S/C29H30O5/c1-33-26-7-4-17(28(32)34-18-5-2-16(3-6-18)27(30)31)11-25(26)29-12-22-19-8-15-9-20(22)24(14-29)21(10-15)23(19)13-29/h2-7,11,15,19-24H,8-10,12-14H2,1H3,(H,30,31) |
| InChIKey | BESPUIMLFPFJEX-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|