C25H27NO4 — CID 19805174
(4-carbamoylphenyl) 3-(1-adamantyl)-4-methoxybenzoate (PubChem CID 19805174) has the molecular formula C25H27NO4 and a molecular weight of 405.49 g/mol. Its IUPAC name is (4-carbamoylphenyl) 3-(1-adamantyl)-4-methoxybenzoate.
| Compound Name | (4-carbamoylphenyl) 3-(1-adamantyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 19805174 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | (4-carbamoylphenyl) 3-(1-adamantyl)-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(C(N)=O)cc2)cc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H27NO4/c1-29-22-7-4-19(24(28)30-20-5-2-18(3-6-20)23(26)27)11-21(22)25-12-15-8-16(13-25)10-17(9-15)14-25/h2-7,11,15-17H,8-10,12-14H2,1H3,(H2,26,27) |
| InChIKey | ZBYNHXOYHSZOFO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|