C25H28O4 — CID 54535599
4-[[2-(1-adamantyl)-4-methoxyphenyl]-hydroxymethyl]benzoic acid (PubChem CID 54535599) has the molecular formula C25H28O4 and a molecular weight of 392.50 g/mol. Its IUPAC name is 4-[[2-(1-adamantyl)-4-methoxyphenyl]-hydroxymethyl]benzoic acid.
| Compound Name | 4-[[2-(1-adamantyl)-4-methoxyphenyl]-hydroxymethyl]benzoic acid |
|---|---|
| PubChem CID | 54535599 |
| Molecular Formula | C25H28O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 4-[[2-(1-adamantyl)-4-methoxyphenyl]-hydroxymethyl]benzoic acid |
| SMILES | COc1ccc(C(O)c2ccc(C(=O)O)cc2)c(C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C25H28O4/c1-29-20-6-7-21(23(26)18-2-4-19(5-3-18)24(27)28)22(11-20)25-12-15-8-16(13-25)10-17(9-15)14-25/h2-7,11,15-17,23,26H,8-10,12-14H2,1H3,(H,27,28) |
| InChIKey | YZOBTSUVSYDVGB-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |