C27H28O4 — CID 67832924
4-[3-(1-adamantyl)-4-prop-2-enylbenzoyl]oxybenzoic acid (PubChem CID 67832924) has the molecular formula C27H28O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is 4-[3-(1-adamantyl)-4-prop-2-enylbenzoyl]oxybenzoic acid.
| Compound Name | 4-[3-(1-adamantyl)-4-prop-2-enylbenzoyl]oxybenzoic acid |
|---|---|
| PubChem CID | 67832924 |
| Molecular Formula | C27H28O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 4-[3-(1-adamantyl)-4-prop-2-enylbenzoyl]oxybenzoic acid |
| SMILES | C=CCc1ccc(C(=O)Oc2ccc(C(=O)O)cc2)cc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H28O4/c1-2-3-20-4-5-22(26(30)31-23-8-6-21(7-9-23)25(28)29)13-24(20)27-14-17-10-18(15-27)12-19(11-17)16-27/h2,4-9,13,17-19H,1,3,10-12,14-16H2,(H,28,29) |
| InChIKey | FTLSCSNCTWNRHC-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|