C28H32O4 — CID 15385053
methyl 3-[4-(1-adamantyl)-3-methoxyphenyl]-3-methyl-2H-1-benzofuran-6-carboxylate (PubChem CID 15385053) has the molecular formula C28H32O4 and a molecular weight of 432.56 g/mol. Its IUPAC name is methyl 3-[4-(1-adamantyl)-3-methoxyphenyl]-3-methyl-2H-1-benzofuran-6-carboxylate.
| Compound Name | methyl 3-[4-(1-adamantyl)-3-methoxyphenyl]-3-methyl-2H-1-benzofuran-6-carboxylate |
|---|---|
| PubChem CID | 15385053 |
| Molecular Formula | C28H32O4 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | methyl 3-[4-(1-adamantyl)-3-methoxyphenyl]-3-methyl-2H-1-benzofuran-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)OCC2(C)c1ccc(C23CC4CC(CC(C4)C2)C3)c(OC)c1 |
| InChI | InChI=1S/C28H32O4/c1-27(16-32-25-11-20(26(29)31-3)4-6-22(25)27)21-5-7-23(24(12-21)30-2)28-13-17-8-18(14-28)10-19(9-17)15-28/h4-7,11-12,17-19H,8-10,13-16H2,1-3H3 |
| InChIKey | TWSIIDUNGGGROY-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |