C30H34O4 — CID 19920676
methyl 3-[(Z)-5-[4-(1-adamantyl)-3-methoxyphenyl]-1-oxopent-2-en-2-yl]benzoate (PubChem CID 19920676) has the molecular formula C30H34O4 and a molecular weight of 458.60 g/mol. Its IUPAC name is methyl 3-[(Z)-5-[4-(1-adamantyl)-3-methoxyphenyl]-1-oxopent-2-en-2-yl]benzoate.
| Compound Name | methyl 3-[(Z)-5-[4-(1-adamantyl)-3-methoxyphenyl]-1-oxopent-2-en-2-yl]benzoate |
|---|---|
| PubChem CID | 19920676 |
| Molecular Formula | C30H34O4 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | methyl 3-[(Z)-5-[4-(1-adamantyl)-3-methoxyphenyl]-1-oxopent-2-en-2-yl]benzoate |
| SMILES | COC(=O)c1cccc(/C(C=O)=C/CCc2ccc(C34CC5CC(CC(C5)C3)C4)c(OC)c2)c1 |
| InChI | InChI=1S/C30H34O4/c1-33-28-14-20(5-3-8-26(19-31)24-6-4-7-25(15-24)29(32)34-2)9-10-27(28)30-16-21-11-22(17-30)13-23(12-21)18-30/h4,6-10,14-15,19,21-23H,3,5,11-13,16-18H2,1-2H3/b26-8+ |
| InChIKey | XDSIMRDSLQDEAF-MWRNPHMMSA-N |
| XLogP | 6.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|