C28H32O3 — CID 67693757
5-[4-(1-adamantyl)-3-methoxyphenyl]-2-phenylpent-2-enoic acid (PubChem CID 67693757) has the molecular formula C28H32O3 and a molecular weight of 416.56 g/mol. Its IUPAC name is 5-[4-(1-adamantyl)-3-methoxyphenyl]-2-phenylpent-2-enoic acid.
| Compound Name | 5-[4-(1-adamantyl)-3-methoxyphenyl]-2-phenylpent-2-enoic acid |
|---|---|
| PubChem CID | 67693757 |
| Molecular Formula | C28H32O3 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 5-[4-(1-adamantyl)-3-methoxyphenyl]-2-phenylpent-2-enoic acid |
| SMILES | COc1cc(CCC=C(C(=O)O)c2ccccc2)ccc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C28H32O3/c1-31-26-15-19(6-5-9-24(27(29)30)23-7-3-2-4-8-23)10-11-25(26)28-16-20-12-21(17-28)14-22(13-20)18-28/h2-4,7-11,15,20-22H,5-6,12-14,16-18H2,1H3,(H,29,30) |
| InChIKey | USTRGMFYQAFXKE-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|