C30H31F3O3 — CID 19920594
(2E,4Z)-7-[4-(1-adamantyl)-3-hydroxyphenyl]-4-[3-(trifluoromethyl)phenyl]hepta-2,4-dienoic acid (PubChem CID 19920594) has the molecular formula C30H31F3O3 and a molecular weight of 496.57 g/mol. Its IUPAC name is (2E,4Z)-7-[4-(1-adamantyl)-3-hydroxyphenyl]-4-[3-(trifluoromethyl)phenyl]hepta-2,4-dienoic acid.
| Compound Name | (2E,4Z)-7-[4-(1-adamantyl)-3-hydroxyphenyl]-4-[3-(trifluoromethyl)phenyl]hepta-2,4-dienoic acid |
|---|---|
| PubChem CID | 19920594 |
| Molecular Formula | C30H31F3O3 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | (2E,4Z)-7-[4-(1-adamantyl)-3-hydroxyphenyl]-4-[3-(trifluoromethyl)phenyl]hepta-2,4-dienoic acid |
| SMILES | O=C(O)/C=C/C(=C/CCc1ccc(C23CC4CC(CC(C4)C2)C3)c(O)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H31F3O3/c31-30(32,33)25-6-2-5-24(15-25)23(8-10-28(35)36)4-1-3-19-7-9-26(27(34)14-19)29-16-20-11-21(17-29)13-22(12-20)18-29/h2,4-10,14-15,20-22,34H,1,3,11-13,16-18H2,(H,35,36)/b10-8+,23-4- |
| InChIKey | VGTQKTUSZALGRT-HZESTXQUSA-N |
| XLogP | 7.54 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|