C27H29F3O2 — CID 19920724
(Z)-3-[4-(1-adamantyl)-3-methoxyphenyl]-2-[3-(trifluoromethyl)phenyl]prop-2-en-1-ol (PubChem CID 19920724) has the molecular formula C27H29F3O2 and a molecular weight of 442.52 g/mol. Its IUPAC name is (Z)-3-[4-(1-adamantyl)-3-methoxyphenyl]-2-[3-(trifluoromethyl)phenyl]prop-2-en-1-ol.
| Compound Name | (Z)-3-[4-(1-adamantyl)-3-methoxyphenyl]-2-[3-(trifluoromethyl)phenyl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 19920724 |
| Molecular Formula | C27H29F3O2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | (Z)-3-[4-(1-adamantyl)-3-methoxyphenyl]-2-[3-(trifluoromethyl)phenyl]prop-2-en-1-ol |
| SMILES | COc1cc(/C=C(\CO)c2cccc(C(F)(F)F)c2)ccc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H29F3O2/c1-32-25-11-17(10-22(16-31)21-3-2-4-23(12-21)27(28,29)30)5-6-24(25)26-13-18-7-19(14-26)9-20(8-18)15-26/h2-6,10-12,18-20,31H,7-9,13-16H2,1H3/b22-10+ |
| InChIKey | NSKQXZUWNJBIRM-LSHDLFTRSA-N |
| XLogP | 6.71 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|