C28H31F3O2 — CID 173323781
2-(1-adamantyl)-5-[5-hydroxy-4-[3-(trifluoromethyl)phenyl]pent-3-enyl]phenol (PubChem CID 173323781) has the molecular formula C28H31F3O2 and a molecular weight of 456.55 g/mol. Its IUPAC name is 2-(1-adamantyl)-5-[5-hydroxy-4-[3-(trifluoromethyl)phenyl]pent-3-enyl]phenol.
| Compound Name | 2-(1-adamantyl)-5-[5-hydroxy-4-[3-(trifluoromethyl)phenyl]pent-3-enyl]phenol |
|---|---|
| PubChem CID | 173323781 |
| Molecular Formula | C28H31F3O2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 2-(1-adamantyl)-5-[5-hydroxy-4-[3-(trifluoromethyl)phenyl]pent-3-enyl]phenol |
| SMILES | OCC(=CCCc1ccc(C23CC4CC(CC(C4)C2)C3)c(O)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H31F3O2/c29-28(30,31)24-6-2-4-22(13-24)23(17-32)5-1-3-18-7-8-25(26(33)12-18)27-14-19-9-20(15-27)11-21(10-19)16-27/h2,4-8,12-13,19-21,32-33H,1,3,9-11,14-17H2 |
| InChIKey | XKEAXRODQHVSON-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |