C28H32O2 — CID 19920635
(Z)-5-[3-(1-adamantyl)-4-methoxyphenyl]-2-phenylpent-2-enal (PubChem CID 19920635) has the molecular formula C28H32O2 and a molecular weight of 400.56 g/mol. Its IUPAC name is (Z)-5-[3-(1-adamantyl)-4-methoxyphenyl]-2-phenylpent-2-enal.
| Compound Name | (Z)-5-[3-(1-adamantyl)-4-methoxyphenyl]-2-phenylpent-2-enal |
|---|---|
| PubChem CID | 19920635 |
| Molecular Formula | C28H32O2 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | (Z)-5-[3-(1-adamantyl)-4-methoxyphenyl]-2-phenylpent-2-enal |
| SMILES | COc1ccc(CC/C=C(\C=O)c2ccccc2)cc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C28H32O2/c1-30-27-11-10-20(6-5-9-25(19-29)24-7-3-2-4-8-24)15-26(27)28-16-21-12-22(17-28)14-23(13-21)18-28/h2-4,7-11,15,19,21-23H,5-6,12-14,16-18H2,1H3/b25-9+ |
| InChIKey | RILYMDBAYUTLQY-YCPBAFNGSA-N |
| XLogP | 6.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|