C23H26O3S2 — CID 19068264
5-[[3-(1-adamantyl)-4-methoxyphenyl]sulfanylmethyl]thiophene-3-carboxylic acid (PubChem CID 19068264) has the molecular formula C23H26O3S2 and a molecular weight of 414.59 g/mol. Its IUPAC name is 5-[[3-(1-adamantyl)-4-methoxyphenyl]sulfanylmethyl]thiophene-3-carboxylic acid.
| Compound Name | 5-[[3-(1-adamantyl)-4-methoxyphenyl]sulfanylmethyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 19068264 |
| Molecular Formula | C23H26O3S2 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 5-[[3-(1-adamantyl)-4-methoxyphenyl]sulfanylmethyl]thiophene-3-carboxylic acid |
| SMILES | COc1ccc(SCc2cc(C(=O)O)cs2)cc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H26O3S2/c1-26-21-3-2-18(28-13-19-7-17(12-27-19)22(24)25)8-20(21)23-9-14-4-15(10-23)6-16(5-14)11-23/h2-3,7-8,12,14-16H,4-6,9-11,13H2,1H3,(H,24,25) |
| InChIKey | DMXPTZZWZDBYKN-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |