C24H25ClO2 — CID 139908702
4-(1-adamantyl)-3-phenylmethoxybenzoyl chloride (PubChem CID 139908702) has the molecular formula C24H25ClO2 and a molecular weight of 380.92 g/mol. Its IUPAC name is 4-(1-adamantyl)-3-phenylmethoxybenzoyl chloride.
| Compound Name | 4-(1-adamantyl)-3-phenylmethoxybenzoyl chloride |
|---|---|
| PubChem CID | 139908702 |
| Molecular Formula | C24H25ClO2 |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 4-(1-adamantyl)-3-phenylmethoxybenzoyl chloride |
| SMILES | O=C(Cl)c1ccc(C23CC4CC(CC(C4)C2)C3)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C24H25ClO2/c25-23(26)20-6-7-21(22(11-20)27-15-16-4-2-1-3-5-16)24-12-17-8-18(13-24)10-19(9-17)14-24/h1-7,11,17-19H,8-10,12-15H2 |
| InChIKey | BCSNMRXHJRONCR-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|