4-(1-adamantyl)-3-phenylmethoxybenzoyl chloride

C24H25ClO2 — CID 139908702

IUPAC4-(1-adamantyl)-3-phenylmethoxybenzoyl chloride
SMILESO=C(Cl)c1ccc(C23CC4CC(CC(C4)C2)C3)c(OCc2ccccc2)c1
InChIInChI=1S/C24H25ClO2/c25-23(26)20-6-7-21(22(11-20)27-15-16-4-2-1-3-5-16)24-12-17-8-18(13-24)10-19(9-17)14-24/h1-7,11,17-19H,8-10,12-15H2
InChIKeyBCSNMRXHJRONCR-UHFFFAOYSA-N
MW380.92 g/mol
LogP6.11
Rot. Bonds5

About 4-(1-adamantyl)-3-phenylmethoxybenzoyl chloride

4-(1-adamantyl)-3-phenylmethoxybenzoyl chloride (PubChem CID 139908702) has the molecular formula C24H25ClO2 and a molecular weight of 380.92 g/mol. Its IUPAC name is 4-(1-adamantyl)-3-phenylmethoxybenzoyl chloride.

Molecular Properties

Compound Name4-(1-adamantyl)-3-phenylmethoxybenzoyl chloride
PubChem CID139908702
Molecular FormulaC24H25ClO2
Molecular Weight380.92 g/mol
Exact Mass380.15
IUPAC Name4-(1-adamantyl)-3-phenylmethoxybenzoyl chloride
SMILESO=C(Cl)c1ccc(C23CC4CC(CC(C4)C2)C3)c(OCc2ccccc2)c1
InChIInChI=1S/C24H25ClO2/c25-23(26)20-6-7-21(22(11-20)27-15-16-4-2-1-3-5-16)24-12-17-8-18(13-24)10-19(9-17)14-24/h1-7,11,17-19H,8-10,12-15H2
InChIKeyBCSNMRXHJRONCR-UHFFFAOYSA-N
XLogP6.11
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms27
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500380.92
LogP ≤ 56.11
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 4-(1-adamantyl)-3-phenylmethoxybenzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1-adamantyl)-3-phenylmethoxybenzoyl chloride?
The IUPAC name of 4-(1-adamantyl)-3-phenylmethoxybenzoyl chloride (CID 139908702) is 4-(1-adamantyl)-3-phenylmethoxybenzoyl chloride.
What is the SMILES notation for 4-(1-adamantyl)-3-phenylmethoxybenzoyl chloride?
The canonical SMILES for 4-(1-adamantyl)-3-phenylmethoxybenzoyl chloride is O=C(Cl)c1ccc(C23CC4CC(CC(C4)C2)C3)c(OCc2ccccc2)c1.
What is the InChIKey of 4-(1-adamantyl)-3-phenylmethoxybenzoyl chloride?
The InChIKey is BCSNMRXHJRONCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25ClO2/c25-23(26)20-6-7-21(22(11-20)27-15-16-4-2-1-3-5-16)24-12-17-8-18(13-24)10-19(9-17)14-24/h1-7,11,17-19H,8-10,12-15H2.
What are the key properties of 4-(1-adamantyl)-3-phenylmethoxybenzoyl chloride?
4-(1-adamantyl)-3-phenylmethoxybenzoyl chloride has a molecular weight of 380.92 g/mol, XLogP of 6.11, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-adamantyl)-3-phenylmethoxybenzoyl chloride is sourced from PubChem (CID 139908702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).