C30H31NO3Se — CID 10673818
6-[5-(1-adamantyl)-2-methyl-4-phenylmethoxyphenyl]selanylpyridine-3-carboxylic acid (PubChem CID 10673818) has the molecular formula C30H31NO3Se and a molecular weight of 532.54 g/mol. Its IUPAC name is 6-[5-(1-adamantyl)-2-methyl-4-phenylmethoxyphenyl]selanylpyridine-3-carboxylic acid.
| Compound Name | 6-[5-(1-adamantyl)-2-methyl-4-phenylmethoxyphenyl]selanylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 10673818 |
| Molecular Formula | C30H31NO3Se |
| Molecular Weight | 532.54 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | 6-[5-(1-adamantyl)-2-methyl-4-phenylmethoxyphenyl]selanylpyridine-3-carboxylic acid |
| SMILES | Cc1cc(OCc2ccccc2)c(C23CC4CC(CC(C4)C2)C3)cc1[Se]c1ccc(C(=O)O)cn1 |
| InChI | InChI=1S/C30H31NO3Se/c1-19-9-26(34-18-20-5-3-2-4-6-20)25(30-14-21-10-22(15-30)12-23(11-21)16-30)13-27(19)35-28-8-7-24(17-31-28)29(32)33/h2-9,13,17,21-23H,10-12,14-16,18H2,1H3,(H,32,33) |
| InChIKey | GTOBUCBVHINQHC-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.54 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|