C28H30N2O3 — CID 141493663
4-[3-[3-(1-adamantyl)-4-ethoxyphenyl]-1H-pyrazol-5-yl]benzoic acid (PubChem CID 141493663) has the molecular formula C28H30N2O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is 4-[3-[3-(1-adamantyl)-4-ethoxyphenyl]-1H-pyrazol-5-yl]benzoic acid.
| Compound Name | 4-[3-[3-(1-adamantyl)-4-ethoxyphenyl]-1H-pyrazol-5-yl]benzoic acid |
|---|---|
| PubChem CID | 141493663 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 4-[3-[3-(1-adamantyl)-4-ethoxyphenyl]-1H-pyrazol-5-yl]benzoic acid |
| SMILES | CCOc1ccc(-c2cc(-c3ccc(C(=O)O)cc3)[nH]n2)cc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C28H30N2O3/c1-2-33-26-8-7-22(12-23(26)28-14-17-9-18(15-28)11-19(10-17)16-28)25-13-24(29-30-25)20-3-5-21(6-4-20)27(31)32/h3-8,12-13,17-19H,2,9-11,14-16H2,1H3,(H,29,30)(H,31,32) |
| InChIKey | UXEDETHINXWWEK-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |