C24H29BO4 — CID 67209081
[5-(1-adamantyl)-2-methoxy-4-phenylmethoxyphenyl]boronic acid (PubChem CID 67209081) has the molecular formula C24H29BO4 and a molecular weight of 392.30 g/mol. Its IUPAC name is [5-(1-adamantyl)-2-methoxy-4-phenylmethoxyphenyl]boronic acid.
| Compound Name | [5-(1-adamantyl)-2-methoxy-4-phenylmethoxyphenyl]boronic acid |
|---|---|
| PubChem CID | 67209081 |
| Molecular Formula | C24H29BO4 |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | [5-(1-adamantyl)-2-methoxy-4-phenylmethoxyphenyl]boronic acid |
| SMILES | COc1cc(OCc2ccccc2)c(C23CC4CC(CC(C4)C2)C3)cc1B(O)O |
| InChI | InChI=1S/C24H29BO4/c1-28-23-11-22(29-15-16-5-3-2-4-6-16)20(10-21(23)25(26)27)24-12-17-7-18(13-24)9-19(8-17)14-24/h2-6,10-11,17-19,26-27H,7-9,12-15H2,1H3 |
| InChIKey | LVNJVGMZZCCRQH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|