C46H50O2Se2 — CID 87929939
1-[4-[[4-(1-adamantyl)-3-phenylmethoxyphenyl]diselanyl]-2-phenylmethoxyphenyl]adamantane (PubChem CID 87929939) has the molecular formula C46H50O2Se2 and a molecular weight of 792.82 g/mol. Its IUPAC name is 1-[4-[[4-(1-adamantyl)-3-phenylmethoxyphenyl]diselanyl]-2-phenylmethoxyphenyl]adamantane.
| Compound Name | 1-[4-[[4-(1-adamantyl)-3-phenylmethoxyphenyl]diselanyl]-2-phenylmethoxyphenyl]adamantane |
|---|---|
| PubChem CID | 87929939 |
| Molecular Formula | C46H50O2Se2 |
| Molecular Weight | 792.82 g/mol |
| Exact Mass | 794.21 |
| IUPAC Name | 1-[4-[[4-(1-adamantyl)-3-phenylmethoxyphenyl]diselanyl]-2-phenylmethoxyphenyl]adamantane |
| SMILES | c1ccc(COc2cc([Se][Se]c3ccc(C45CC6CC(CC(C6)C4)C5)c(OCc4ccccc4)c3)ccc2C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C46H50O2Se2/c1-3-7-31(8-4-1)29-47-43-21-39(11-13-41(43)45-23-33-15-34(24-45)17-35(16-33)25-45)49-50-40-12-14-42(44(22-40)48-30-32-9-5-2-6-10-32)46-26-36-18-37(27-46)20-38(19-36)28-46/h1-14,21-22,33-38H,15-20,23-30H2 |
| InChIKey | QFJAQQPJPJGCNQ-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.82 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|