C34H35NO3 — CID 22134793
ethyl 5-[3-(1-adamantyl)-4-phenylmethoxyphenyl]-1H-indole-2-carboxylate (PubChem CID 22134793) has the molecular formula C34H35NO3 and a molecular weight of 505.66 g/mol. Its IUPAC name is ethyl 5-[3-(1-adamantyl)-4-phenylmethoxyphenyl]-1H-indole-2-carboxylate.
| Compound Name | ethyl 5-[3-(1-adamantyl)-4-phenylmethoxyphenyl]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 22134793 |
| Molecular Formula | C34H35NO3 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | ethyl 5-[3-(1-adamantyl)-4-phenylmethoxyphenyl]-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(-c3ccc(OCc4ccccc4)c(C45CC6CC(CC(C6)C4)C5)c3)ccc2[nH]1 |
| InChI | InChI=1S/C34H35NO3/c1-2-37-33(36)31-17-28-15-26(8-10-30(28)35-31)27-9-11-32(38-21-22-6-4-3-5-7-22)29(16-27)34-18-23-12-24(19-34)14-25(13-23)20-34/h3-11,15-17,23-25,35H,2,12-14,18-21H2,1H3 |
| InChIKey | YYXMUKSGFDZQGV-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |