C36H40O5 — CID 173068422
3-[4-[3-(1-adamantyl)-4-phenylmethoxyphenyl]-2-ethyl-3,5-dimethoxyphenyl]prop-2-enoic acid (PubChem CID 173068422) has the molecular formula C36H40O5 and a molecular weight of 552.71 g/mol. Its IUPAC name is 3-[4-[3-(1-adamantyl)-4-phenylmethoxyphenyl]-2-ethyl-3,5-dimethoxyphenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[3-(1-adamantyl)-4-phenylmethoxyphenyl]-2-ethyl-3,5-dimethoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 173068422 |
| Molecular Formula | C36H40O5 |
| Molecular Weight | 552.71 g/mol |
| Exact Mass | 552.29 |
| IUPAC Name | 3-[4-[3-(1-adamantyl)-4-phenylmethoxyphenyl]-2-ethyl-3,5-dimethoxyphenyl]prop-2-enoic acid |
| SMILES | CCc1c(C=CC(=O)O)cc(OC)c(-c2ccc(OCc3ccccc3)c(C34CC5CC(CC(C5)C3)C4)c2)c1OC |
| InChI | InChI=1S/C36H40O5/c1-4-29-27(11-13-33(37)38)18-32(39-2)34(35(29)40-3)28-10-12-31(41-22-23-8-6-5-7-9-23)30(17-28)36-19-24-14-25(20-36)16-26(15-24)21-36/h5-13,17-18,24-26H,4,14-16,19-22H2,1-3H3,(H,37,38) |
| InChIKey | IGQQSCGKUVYXNA-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.71 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|