C40H36N4 — CID 176633274
2-[3-(1-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecanyl)-5-pyridin-3-ylphenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 176633274) has the molecular formula C40H36N4 and a molecular weight of 572.76 g/mol. Its IUPAC name is 2-[3-(1-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecanyl)-5-pyridin-3-ylphenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3-(1-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecanyl)-5-pyridin-3-ylphenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 176633274 |
| Molecular Formula | C40H36N4 |
| Molecular Weight | 572.76 g/mol |
| Exact Mass | 572.29 |
| IUPAC Name | 2-[3-(1-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecanyl)-5-pyridin-3-ylphenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cc(-c4cccnc4)cc(C45CC6CC7C8CC(CC74)CC5C8C6)c3)n2)cc1 |
| InChI | InChI=1S/C40H36N4/c1-3-8-26(9-4-1)37-42-38(27-10-5-2-6-11-27)44-39(43-37)30-19-29(28-12-7-13-41-23-28)20-31(21-30)40-22-25-15-33-32-14-24(17-35(33)40)18-36(40)34(32)16-25/h1-13,19-21,23-25,32-36H,14-18,22H2 |
| InChIKey | GPRTYRJBKUDZEY-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.76 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |