C12H9F3N2O4S — CID 139683412
[4-(1,2,4-oxadiazol-3-yl)-2-prop-2-enylphenyl] trifluoromethanesulfonate (PubChem CID 139683412) has the molecular formula C12H9F3N2O4S and a molecular weight of 334.28 g/mol. Its IUPAC name is [4-(1,2,4-oxadiazol-3-yl)-2-prop-2-enylphenyl] trifluoromethanesulfonate.
| Compound Name | [4-(1,2,4-oxadiazol-3-yl)-2-prop-2-enylphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139683412 |
| Molecular Formula | C12H9F3N2O4S |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | [4-(1,2,4-oxadiazol-3-yl)-2-prop-2-enylphenyl] trifluoromethanesulfonate |
| SMILES | C=CCc1cc(-c2ncon2)ccc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C12H9F3N2O4S/c1-2-3-8-6-9(11-16-7-20-17-11)4-5-10(8)21-22(18,19)12(13,14)15/h2,4-7H,1,3H2 |
| InChIKey | GGWRPHZGOKMCFI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|