C38H31F3O6S2 — CID 139795880
[4-[1-[4-(benzenesulfonyloxy)-3-prop-2-enylphenyl]-2,2,2-trifluoro-1-phenylethyl]-2-prop-2-enylphenyl] benzenesulfonate (PubChem CID 139795880) has the molecular formula C38H31F3O6S2 and a molecular weight of 704.79 g/mol. Its IUPAC name is [4-[1-[4-(benzenesulfonyloxy)-3-prop-2-enylphenyl]-2,2,2-trifluoro-1-phenylethyl]-2-prop-2-enylphenyl] benzenesulfonate.
| Compound Name | [4-[1-[4-(benzenesulfonyloxy)-3-prop-2-enylphenyl]-2,2,2-trifluoro-1-phenylethyl]-2-prop-2-enylphenyl] benzenesulfonate |
|---|---|
| PubChem CID | 139795880 |
| Molecular Formula | C38H31F3O6S2 |
| Molecular Weight | 704.79 g/mol |
| Exact Mass | 704.15 |
| IUPAC Name | [4-[1-[4-(benzenesulfonyloxy)-3-prop-2-enylphenyl]-2,2,2-trifluoro-1-phenylethyl]-2-prop-2-enylphenyl] benzenesulfonate |
| SMILES | C=CCc1cc(C(c2ccccc2)(c2ccc(OS(=O)(=O)c3ccccc3)c(CC=C)c2)C(F)(F)F)ccc1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C38H31F3O6S2/c1-3-14-28-26-31(22-24-35(28)46-48(42,43)33-18-10-6-11-19-33)37(38(39,40)41,30-16-8-5-9-17-30)32-23-25-36(29(27-32)15-4-2)47-49(44,45)34-20-12-7-13-21-34/h3-13,16-27H,1-2,14-15H2 |
| InChIKey | IHGYYUVOBVGLHC-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.79 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|