C45H40O6S2 — CID 139795895
[4-[[4-(4-methylphenyl)sulfonyloxy-3-prop-2-enylphenyl]-diphenylmethyl]-2-prop-2-enylphenyl] 4-methylbenzenesulfonate (PubChem CID 139795895) has the molecular formula C45H40O6S2 and a molecular weight of 740.94 g/mol. Its IUPAC name is [4-[[4-(4-methylphenyl)sulfonyloxy-3-prop-2-enylphenyl]-diphenylmethyl]-2-prop-2-enylphenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[[4-(4-methylphenyl)sulfonyloxy-3-prop-2-enylphenyl]-diphenylmethyl]-2-prop-2-enylphenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139795895 |
| Molecular Formula | C45H40O6S2 |
| Molecular Weight | 740.94 g/mol |
| Exact Mass | 740.23 |
| IUPAC Name | [4-[[4-(4-methylphenyl)sulfonyloxy-3-prop-2-enylphenyl]-diphenylmethyl]-2-prop-2-enylphenyl] 4-methylbenzenesulfonate |
| SMILES | C=CCc1cc(C(c2ccccc2)(c2ccccc2)c2ccc(OS(=O)(=O)c3ccc(C)cc3)c(CC=C)c2)ccc1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C45H40O6S2/c1-5-13-35-31-39(23-29-43(35)50-52(46,47)41-25-19-33(3)20-26-41)45(37-15-9-7-10-16-37,38-17-11-8-12-18-38)40-24-30-44(36(32-40)14-6-2)51-53(48,49)42-27-21-34(4)22-28-42/h5-12,15-32H,1-2,13-14H2,3-4H3 |
| InChIKey | KIEINYJXSZSTDR-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.94 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|