C17H16F2N2O2SSi — CID 141208482
7-fluoro-3-(2-fluoro-4-trimethylsilylanilino)thieno[3,2-c]pyridine-2-carboxylic acid (PubChem CID 141208482) has the molecular formula C17H16F2N2O2SSi and a molecular weight of 378.48 g/mol. Its IUPAC name is 7-fluoro-3-(2-fluoro-4-trimethylsilylanilino)thieno[3,2-c]pyridine-2-carboxylic acid.
| Compound Name | 7-fluoro-3-(2-fluoro-4-trimethylsilylanilino)thieno[3,2-c]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 141208482 |
| Molecular Formula | C17H16F2N2O2SSi |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 7-fluoro-3-(2-fluoro-4-trimethylsilylanilino)thieno[3,2-c]pyridine-2-carboxylic acid |
| SMILES | C[Si](C)(C)c1ccc(Nc2c(C(=O)O)sc3c(F)cncc23)c(F)c1 |
| InChI | InChI=1S/C17H16F2N2O2SSi/c1-25(2,3)9-4-5-13(11(18)6-9)21-14-10-7-20-8-12(19)15(10)24-16(14)17(22)23/h4-8,21H,1-3H3,(H,22,23) |
| InChIKey | LVXMMSWJGKKNFL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|