C18H17FINO3 — CID 59865175
ethyl 2-[(2-fluoro-4-iodophenyl)methyl]-7-oxo-1,4,5,6-tetrahydroindole-3-carboxylate (PubChem CID 59865175) has the molecular formula C18H17FINO3 and a molecular weight of 441.24 g/mol. Its IUPAC name is ethyl 2-[(2-fluoro-4-iodophenyl)methyl]-7-oxo-1,4,5,6-tetrahydroindole-3-carboxylate.
| Compound Name | ethyl 2-[(2-fluoro-4-iodophenyl)methyl]-7-oxo-1,4,5,6-tetrahydroindole-3-carboxylate |
|---|---|
| PubChem CID | 59865175 |
| Molecular Formula | C18H17FINO3 |
| Molecular Weight | 441.24 g/mol |
| Exact Mass | 441.02 |
| IUPAC Name | ethyl 2-[(2-fluoro-4-iodophenyl)methyl]-7-oxo-1,4,5,6-tetrahydroindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(Cc2ccc(I)cc2F)[nH]c2c1CCCC2=O |
| InChI | InChI=1S/C18H17FINO3/c1-2-24-18(23)16-12-4-3-5-15(22)17(12)21-14(16)8-10-6-7-11(20)9-13(10)19/h6-7,9,21H,2-5,8H2,1H3 |
| InChIKey | ALBBAAASZKKVJU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.24 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|