C17H19NO5 — CID 171867124
ethyl 2,3-dihydroxy-3-(8-oxo-5,6,7,9-tetrahydrocarbazol-3-yl)propanoate (PubChem CID 171867124) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is ethyl 2,3-dihydroxy-3-(8-oxo-5,6,7,9-tetrahydrocarbazol-3-yl)propanoate.
| Compound Name | ethyl 2,3-dihydroxy-3-(8-oxo-5,6,7,9-tetrahydrocarbazol-3-yl)propanoate |
|---|---|
| PubChem CID | 171867124 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | ethyl 2,3-dihydroxy-3-(8-oxo-5,6,7,9-tetrahydrocarbazol-3-yl)propanoate |
| SMILES | CCOC(=O)C(O)C(O)c1ccc2[nH]c3c(c2c1)CCCC3=O |
| InChI | InChI=1S/C17H19NO5/c1-2-23-17(22)16(21)15(20)9-6-7-12-11(8-9)10-4-3-5-13(19)14(10)18-12/h6-8,15-16,18,20-21H,2-5H2,1H3 |
| InChIKey | JVGKULUPNPZOMS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|