C15H13NOS — CID 169487550
6-(3-sulfanylprop-1-ynyl)-2,3,4,9-tetrahydrocarbazol-1-one (PubChem CID 169487550) has the molecular formula C15H13NOS and a molecular weight of 255.34 g/mol. Its IUPAC name is 6-(3-sulfanylprop-1-ynyl)-2,3,4,9-tetrahydrocarbazol-1-one.
| Compound Name | 6-(3-sulfanylprop-1-ynyl)-2,3,4,9-tetrahydrocarbazol-1-one |
|---|---|
| PubChem CID | 169487550 |
| Molecular Formula | C15H13NOS |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 6-(3-sulfanylprop-1-ynyl)-2,3,4,9-tetrahydrocarbazol-1-one |
| SMILES | O=C1CCCc2c1[nH]c1ccc(C#CCS)cc21 |
| InChI | InChI=1S/C15H13NOS/c17-14-5-1-4-11-12-9-10(3-2-8-18)6-7-13(12)16-15(11)14/h6-7,9,16,18H,1,4-5,8H2 |
| InChIKey | RYUBYKIFINCWOE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|