C16H16ClNO — CID 170500123
6-(4-chlorobut-1-enyl)-2,3,4,9-tetrahydrocarbazol-1-one (PubChem CID 170500123) has the molecular formula C16H16ClNO and a molecular weight of 273.76 g/mol. Its IUPAC name is 6-(4-chlorobut-1-enyl)-2,3,4,9-tetrahydrocarbazol-1-one.
| Compound Name | 6-(4-chlorobut-1-enyl)-2,3,4,9-tetrahydrocarbazol-1-one |
|---|---|
| PubChem CID | 170500123 |
| Molecular Formula | C16H16ClNO |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 6-(4-chlorobut-1-enyl)-2,3,4,9-tetrahydrocarbazol-1-one |
| SMILES | O=C1CCCc2c1[nH]c1ccc(C=CCCCl)cc21 |
| InChI | InChI=1S/C16H16ClNO/c17-9-2-1-4-11-7-8-14-13(10-11)12-5-3-6-15(19)16(12)18-14/h1,4,7-8,10,18H,2-3,5-6,9H2 |
| InChIKey | QPPIXFDINNVZMG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|