C17H17NO2S — CID 169458208
S-[3-(8-oxo-5,6,7,9-tetrahydrocarbazol-3-yl)prop-2-enyl] ethanethioate (PubChem CID 169458208) has the molecular formula C17H17NO2S and a molecular weight of 299.40 g/mol. Its IUPAC name is S-[3-(8-oxo-5,6,7,9-tetrahydrocarbazol-3-yl)prop-2-enyl] ethanethioate.
| Compound Name | S-[3-(8-oxo-5,6,7,9-tetrahydrocarbazol-3-yl)prop-2-enyl] ethanethioate |
|---|---|
| PubChem CID | 169458208 |
| Molecular Formula | C17H17NO2S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | S-[3-(8-oxo-5,6,7,9-tetrahydrocarbazol-3-yl)prop-2-enyl] ethanethioate |
| SMILES | CC(=O)SCC=Cc1ccc2[nH]c3c(c2c1)CCCC3=O |
| InChI | InChI=1S/C17H17NO2S/c1-11(19)21-9-3-4-12-7-8-15-14(10-12)13-5-2-6-16(20)17(13)18-15/h3-4,7-8,10,18H,2,5-6,9H2,1H3 |
| InChIKey | OGMLJHZJNBQSGJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|