C14H13NO2S — CID 169457974
S-[3-(3-oxo-2H-isoquinolin-6-yl)prop-2-enyl] ethanethioate (PubChem CID 169457974) has the molecular formula C14H13NO2S and a molecular weight of 259.33 g/mol. Its IUPAC name is S-[3-(3-oxo-2H-isoquinolin-6-yl)prop-2-enyl] ethanethioate.
| Compound Name | S-[3-(3-oxo-2H-isoquinolin-6-yl)prop-2-enyl] ethanethioate |
|---|---|
| PubChem CID | 169457974 |
| Molecular Formula | C14H13NO2S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | S-[3-(3-oxo-2H-isoquinolin-6-yl)prop-2-enyl] ethanethioate |
| SMILES | CC(=O)SCC=Cc1ccc2c[nH]c(=O)cc2c1 |
| InChI | InChI=1S/C14H13NO2S/c1-10(16)18-6-2-3-11-4-5-12-9-15-14(17)8-13(12)7-11/h2-5,7-9H,6H2,1H3,(H,15,17) |
| InChIKey | UGSSHYLOXJIQER-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|