C13H14N2OS — CID 169457386
S-[3-(2-methyl-3H-benzimidazol-5-yl)prop-2-enyl] ethanethioate (PubChem CID 169457386) has the molecular formula C13H14N2OS and a molecular weight of 246.33 g/mol. Its IUPAC name is S-[3-(2-methyl-3H-benzimidazol-5-yl)prop-2-enyl] ethanethioate.
| Compound Name | S-[3-(2-methyl-3H-benzimidazol-5-yl)prop-2-enyl] ethanethioate |
|---|---|
| PubChem CID | 169457386 |
| Molecular Formula | C13H14N2OS |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | S-[3-(2-methyl-3H-benzimidazol-5-yl)prop-2-enyl] ethanethioate |
| SMILES | CC(=O)SCC=Cc1ccc2nc(C)[nH]c2c1 |
| InChI | InChI=1S/C13H14N2OS/c1-9-14-12-6-5-11(8-13(12)15-9)4-3-7-17-10(2)16/h3-6,8H,7H2,1-2H3,(H,14,15) |
| InChIKey | BJZBMTOZMGSDQW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|