C29H33BN2O5 — CID 170813718
benzyl N-[3-(8-oxo-5,6,7,9-tetrahydrocarbazol-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170813718) has the molecular formula C29H33BN2O5 and a molecular weight of 500.40 g/mol. Its IUPAC name is benzyl N-[3-(8-oxo-5,6,7,9-tetrahydrocarbazol-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(8-oxo-5,6,7,9-tetrahydrocarbazol-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170813718 |
| Molecular Formula | C29H33BN2O5 |
| Molecular Weight | 500.40 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | benzyl N-[3-(8-oxo-5,6,7,9-tetrahydrocarbazol-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC1(C)OB(C(=Cc2ccc3[nH]c4c(c3c2)CCCC4=O)CNC(=O)OCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C29H33BN2O5/c1-28(2)29(3,4)37-30(36-28)21(17-31-27(34)35-18-19-9-6-5-7-10-19)15-20-13-14-24-23(16-20)22-11-8-12-25(33)26(22)32-24/h5-7,9-10,13-16,32H,8,11-12,17-18H2,1-4H3,(H,31,34) |
| InChIKey | ZXKCCVPGPGJWER-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.40 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|