C14H20N2O2 — CID 143687092
N-butyl-2-methyl-7-oxo-1,4,5,6-tetrahydroindole-3-carboxamide (PubChem CID 143687092) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is N-butyl-2-methyl-7-oxo-1,4,5,6-tetrahydroindole-3-carboxamide.
| Compound Name | N-butyl-2-methyl-7-oxo-1,4,5,6-tetrahydroindole-3-carboxamide |
|---|---|
| PubChem CID | 143687092 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | N-butyl-2-methyl-7-oxo-1,4,5,6-tetrahydroindole-3-carboxamide |
| SMILES | CCCCNC(=O)c1c(C)[nH]c2c1CCCC2=O |
| InChI | InChI=1S/C14H20N2O2/c1-3-4-8-15-14(18)12-9(2)16-13-10(12)6-5-7-11(13)17/h16H,3-8H2,1-2H3,(H,15,18) |
| InChIKey | IRBGFCMNEIUKOR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|